C28H57NO5Si2 — CID 134835360
tert-butyl (4S)-4-[(1S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134835360) has the molecular formula C28H57NO5Si2 and a molecular weight of 543.94 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134835360 |
| Molecular Formula | C28H57NO5Si2 |
| Molecular Weight | 543.94 g/mol |
| Exact Mass | 543.38 |
| IUPAC Name | tert-butyl (4S)-4-[(1S,3R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H57NO5Si2/c1-17-18-21(33-35(13,14)26(5,6)7)19-23(34-36(15,16)27(8,9)10)22-20-31-28(11,12)29(22)24(30)32-25(2,3)4/h17,21-23H,1,18-20H2,2-16H3/t21-,22+,23+/m1/s1 |
| InChIKey | YETQFDHIYVJSHO-VJBWXMMDSA-N |
| XLogP | 8.11 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.94 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|