About (4E)-N,N,4-trimethylhepta-4,6-dienamide
(4E)-N,N,4-trimethylhepta-4,6-dienamide (PubChem CID 13483540) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (4E)-N,N,4-trimethylhepta-4,6-dienamide.
Molecular Properties
| Compound Name | (4E)-N,N,4-trimethylhepta-4,6-dienamide |
| PubChem CID | 13483540 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4E)-N,N,4-trimethylhepta-4,6-dienamide |
| SMILES | C/C(=C\C=C)/CCC(=O)N(C)C |
| InChI | InChI=1S/C10H17NO/c1-5-6-9(2)7-8-10(12)11(3)4/h5-6H,1,7-8H2,2-4H3/b9-6+ |
| InChIKey | CTGSMQKZZXJJIN-RMKNXTFCSA-N |
| XLogP | 2.00 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | 192 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-N,N,4-trimethylhepta-4,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-N,N,4-trimethylhepta-4,6-dienamide?
The IUPAC name of (4E)-N,N,4-trimethylhepta-4,6-dienamide (CID 13483540) is (4E)-N,N,4-trimethylhepta-4,6-dienamide.
What is the SMILES notation for (4E)-N,N,4-trimethylhepta-4,6-dienamide?
The canonical SMILES for (4E)-N,N,4-trimethylhepta-4,6-dienamide is C/C(=C\C=C)/CCC(=O)N(C)C.
What is the InChIKey of (4E)-N,N,4-trimethylhepta-4,6-dienamide?
The InChIKey is CTGSMQKZZXJJIN-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H17NO/c1-5-6-9(2)7-8-10(12)11(3)4/h5-6H,1,7-8H2,2-4H3/b9-6+.
What are the key properties of (4E)-N,N,4-trimethylhepta-4,6-dienamide?
(4E)-N,N,4-trimethylhepta-4,6-dienamide has a molecular weight of 167.25 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-N,N,4-trimethylhepta-4,6-dienamide is sourced from PubChem (CID 13483540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).