About methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate
methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 134835435) has the molecular formula C19H19F2NO4
and a molecular weight of 363.36 g/mol. Its IUPAC name is methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate.
Molecular Properties
| Compound Name | methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
| PubChem CID | 134835435 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)C(F)(F)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19F2NO4/c1-25-17(23)19(20,21)16(12-14-8-4-2-5-9-14)22-18(24)26-13-15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | DZSFZTBKPUAGLA-INIZCTEOSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate?
The IUPAC name of methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate (CID 134835435) is methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate.
What is the SMILES notation for methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate?
The canonical SMILES for methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate is COC(=O)C(F)(F)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1.
What is the InChIKey of methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate?
The InChIKey is DZSFZTBKPUAGLA-INIZCTEOSA-N. The full InChI is InChI=1S/C19H19F2NO4/c1-25-17(23)19(20,21)16(12-14-8-4-2-5-9-14)22-18(24)26-13-15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3,(H,22,24)/t16-/m0/s1.
What are the key properties of methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate?
methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate has a molecular weight of 363.36 g/mol, XLogP of 3.33, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-2,2-difluoro-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate is sourced from PubChem (CID 134835435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).