C20H20NO7P — CID 134835500
[(3R,9R)-5,11-diphenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl] dihydrogen phosphite (PubChem CID 134835500) has the molecular formula C20H20NO7P and a molecular weight of 417.35 g/mol. Its IUPAC name is [(3R,9R)-5,11-diphenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl] dihydrogen phosphite.
| Compound Name | [(3R,9R)-5,11-diphenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl] dihydrogen phosphite |
|---|---|
| PubChem CID | 134835500 |
| Molecular Formula | C20H20NO7P |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [(3R,9R)-5,11-diphenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl] dihydrogen phosphite |
| SMILES | OP(O)OC1C2N=C(c3ccccc3)O[C@H]2OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C20H20NO7P/c22-29(23)28-17-15-20(27-18(21-15)12-7-3-1-4-8-12)25-14-11-24-19(26-16(14)17)13-9-5-2-6-10-13/h1-10,14-17,19-20,22-23H,11H2/t14?,15?,16-,17?,19?,20-/m1/s1 |
| InChIKey | ILFRVTXHJTZTIZ-ZAOCBFKOSA-N |
| XLogP | 2.27 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|