C33H50O8Si — CID 134835643
tert-butyl 2-[(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxyacetate (PubChem CID 134835643) has the molecular formula C33H50O8Si and a molecular weight of 602.84 g/mol. Its IUPAC name is tert-butyl 2-[(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxyacetate.
| Compound Name | tert-butyl 2-[(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxyacetate |
|---|---|
| PubChem CID | 134835643 |
| Molecular Formula | C33H50O8Si |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | tert-butyl 2-[(2S,3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl]oxyacetate |
| SMILES | CO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H50O8Si/c1-32(2,3)41-27(34)23-38-30-29(37-21-25-18-14-11-15-19-25)28(36-20-24-16-12-10-13-17-24)26(40-31(30)35-7)22-39-42(8,9)33(4,5)6/h10-19,26,28-31H,20-23H2,1-9H3/t26-,28-,29+,30-,31+/m1/s1 |
| InChIKey | VDSXOYCMWRXVMA-VYYBUWSNSA-N |
| XLogP | 6.28 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|