C24H27BrO10 — CID 134835764
[(3R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate (PubChem CID 134835764) has the molecular formula C24H27BrO10 and a molecular weight of 555.37 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134835764 |
| Molecular Formula | C24H27BrO10 |
| Molecular Weight | 555.37 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](CC(=O)/C=C/c2ccc(Br)cc2)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H27BrO10/c1-13(26)31-12-21-23(33-15(3)28)24(34-16(4)29)22(32-14(2)27)20(35-21)11-19(30)10-7-17-5-8-18(25)9-6-17/h5-10,20-24H,11-12H2,1-4H3/b10-7+/t20-,21?,22?,23+,24?/m0/s1 |
| InChIKey | CPOLLHQHGAAYEH-BTIPFUKZSA-N |
| XLogP | 2.55 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|