C17H34N2O3 — CID 134835812
tert-butyl (2R)-4-amino-2-heptyl-5-hydroxypiperidine-1-carboxylate (PubChem CID 134835812) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is tert-butyl (2R)-4-amino-2-heptyl-5-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-amino-2-heptyl-5-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 134835812 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | tert-butyl (2R)-4-amino-2-heptyl-5-hydroxypiperidine-1-carboxylate |
| SMILES | CCCCCCC[C@@H]1CC(N)C(O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34N2O3/c1-5-6-7-8-9-10-13-11-14(18)15(20)12-19(13)16(21)22-17(2,3)4/h13-15,20H,5-12,18H2,1-4H3/t13-,14?,15?/m1/s1 |
| InChIKey | XEMRQJZQHUNNJF-WLYUNCDWSA-N |
| XLogP | 3.04 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|