C13H16F3NO — CID 134835817
(2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoropent-4-en-2-yl]amino]ethanol (PubChem CID 134835817) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoropent-4-en-2-yl]amino]ethanol.
| Compound Name | (2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoropent-4-en-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 134835817 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2R)-2-phenyl-2-[[(2S)-1,1,1-trifluoropent-4-en-2-yl]amino]ethanol |
| SMILES | C=CC[C@H](N[C@@H](CO)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO/c1-2-6-12(13(14,15)16)17-11(9-18)10-7-4-3-5-8-10/h2-5,7-8,11-12,17-18H,1,6,9H2/t11-,12-/m0/s1 |
| InChIKey | QACJJDPSILPWRX-RYUDHWBXSA-N |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|