C19H29NO4Si — CID 134835854
(1S,5R,8S)-2-benzyl-6,6-dimethyl-8-(trimethylsilyloxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one (PubChem CID 134835854) has the molecular formula C19H29NO4Si and a molecular weight of 363.53 g/mol. Its IUPAC name is (1S,5R,8S)-2-benzyl-6,6-dimethyl-8-(trimethylsilyloxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | (1S,5R,8S)-2-benzyl-6,6-dimethyl-8-(trimethylsilyloxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 134835854 |
| Molecular Formula | C19H29NO4Si |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (1S,5R,8S)-2-benzyl-6,6-dimethyl-8-(trimethylsilyloxymethyl)-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-one |
| SMILES | CC1(C)O[C@H](CO[Si](C)(C)C)[C@H]2C(=O)[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C19H29NO4Si/c1-19(2)15-12-22-20(11-14-9-7-6-8-10-14)17(18(15)21)16(24-19)13-23-25(3,4)5/h6-10,15-17H,11-13H2,1-5H3/t15-,16+,17-/m0/s1 |
| InChIKey | IDVONNMLXIAESB-BBWFWOEESA-N |
| XLogP | 3.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|