About methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate
methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate (PubChem CID 134835924) has the molecular formula C20H36O7
and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate.
Molecular Properties
| Compound Name | methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate |
| PubChem CID | 134835924 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate |
| SMILES | COC(=O)C(/C=C/CCCCC(OC)OC)C(O)[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C20H36O7/c1-15(27-18-13-9-10-14-26-18)19(21)16(20(22)25-4)11-7-5-6-8-12-17(23-2)24-3/h7,11,15-19,21H,5-6,8-10,12-14H2,1-4H3/b11-7+/t15-,16?,18?,19?/m0/s1 |
| InChIKey | XGWJNZJMMQKDLZ-XAHYOLLTSA-N |
| XLogP | 2.80 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate?
The IUPAC name of methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate (CID 134835924) is methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate.
What is the SMILES notation for methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate?
The canonical SMILES for methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate is COC(=O)C(/C=C/CCCCC(OC)OC)C(O)[C@H](C)OC1CCCCO1.
What is the InChIKey of methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate?
The InChIKey is XGWJNZJMMQKDLZ-XAHYOLLTSA-N. The full InChI is InChI=1S/C20H36O7/c1-15(27-18-13-9-10-14-26-18)19(21)16(20(22)25-4)11-7-5-6-8-12-17(23-2)24-3/h7,11,15-19,21H,5-6,8-10,12-14H2,1-4H3/b11-7+/t15-,16?,18?,19?/m0/s1.
What are the key properties of methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate?
methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate has a molecular weight of 388.50 g/mol, XLogP of 2.80, 13 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-9,9-dimethoxynon-3-enoate is sourced from PubChem (CID 134835924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).