C18H31BrO2 — CID 134836116
2-bromoethyl (1S,3aS)-6,6,7-trimethyl-1-propan-2-yl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate (PubChem CID 134836116) has the molecular formula C18H31BrO2 and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-bromoethyl (1S,3aS)-6,6,7-trimethyl-1-propan-2-yl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | 2-bromoethyl (1S,3aS)-6,6,7-trimethyl-1-propan-2-yl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 134836116 |
| Molecular Formula | C18H31BrO2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-bromoethyl (1S,3aS)-6,6,7-trimethyl-1-propan-2-yl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@]2(C(=O)OCCBr)CCC(C)(C)C(C)C12 |
| InChI | InChI=1S/C18H31BrO2/c1-12(2)14-6-7-18(16(20)21-11-10-19)9-8-17(4,5)13(3)15(14)18/h12-15H,6-11H2,1-5H3/t13?,14-,15?,18-/m0/s1 |
| InChIKey | RFAQHECDKSBNLB-PPYGMBNGSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|