C13H18O3 — CID 134836181
(5E,7E)-1,1-diethoxynona-5,7-dien-2-yn-4-one (PubChem CID 134836181) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (5E,7E)-1,1-diethoxynona-5,7-dien-2-yn-4-one.
| Compound Name | (5E,7E)-1,1-diethoxynona-5,7-dien-2-yn-4-one |
|---|---|
| PubChem CID | 134836181 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (5E,7E)-1,1-diethoxynona-5,7-dien-2-yn-4-one |
| SMILES | C/C=C/C=C/C(=O)C#CC(OCC)OCC |
| InChI | InChI=1S/C13H18O3/c1-4-7-8-9-12(14)10-11-13(15-5-2)16-6-3/h4,7-9,13H,5-6H2,1-3H3/b7-4+,9-8+ |
| InChIKey | SPFGNEXYDBECEU-NUXDXBQRSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|