About 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene
2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene (PubChem CID 134836464) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene.
Molecular Properties
| Compound Name | 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene |
| PubChem CID | 134836464 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene |
| SMILES | CO[C@@H]1C[C@H](C)CCC1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H26O/c1-13-10-11-15(16(12-13)18-4)17(2,3)14-8-6-5-7-9-14/h5-9,13,15-16H,10-12H2,1-4H3/t13-,15?,16-/m1/s1 |
| InChIKey | UINROOVKBHXLMH-YAELJHOLSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene?
The IUPAC name of 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene (CID 134836464) is 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene.
What is the SMILES notation for 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene?
The canonical SMILES for 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene is CO[C@@H]1C[C@H](C)CCC1C(C)(C)c1ccccc1.
What is the InChIKey of 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene?
The InChIKey is UINROOVKBHXLMH-YAELJHOLSA-N. The full InChI is InChI=1S/C17H26O/c1-13-10-11-15(16(12-13)18-4)17(2,3)14-8-6-5-7-9-14/h5-9,13,15-16H,10-12H2,1-4H3/t13-,15?,16-/m1/s1.
What are the key properties of 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene?
2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene has a molecular weight of 246.39 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4R)-2-methoxy-4-methylcyclohexyl]propan-2-ylbenzene is sourced from PubChem (CID 134836464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).