C21H34O4 — CID 134836523
methyl (1R,3aS,12E)-9-hydroxy-1-(2-hydroxypropan-2-yl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,9,10,11-decahydrocyclopenta[11]annulene-10-carboxylate (PubChem CID 134836523) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl (1R,3aS,12E)-9-hydroxy-1-(2-hydroxypropan-2-yl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,9,10,11-decahydrocyclopenta[11]annulene-10-carboxylate.
| Compound Name | methyl (1R,3aS,12E)-9-hydroxy-1-(2-hydroxypropan-2-yl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,9,10,11-decahydrocyclopenta[11]annulene-10-carboxylate |
|---|---|
| PubChem CID | 134836523 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl (1R,3aS,12E)-9-hydroxy-1-(2-hydroxypropan-2-yl)-3a-methyl-6-methylidene-1,2,3,4,5,7,8,9,10,11-decahydrocyclopenta[11]annulene-10-carboxylate |
| SMILES | C=C1CCC(O)C(C(=O)OC)C/C=C2\[C@H](C(C)(C)O)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C21H34O4/c1-14-6-9-18(22)15(19(23)25-5)7-8-17-16(20(2,3)24)11-13-21(17,4)12-10-14/h8,15-16,18,22,24H,1,6-7,9-13H2,2-5H3/b17-8-/t15?,16-,18?,21-/m1/s1 |
| InChIKey | NTDRZCMYGFXMCJ-LQYOFTBYSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|