C25H28N2O2 — CID 134836537
3-(4-hydroxy-3,4,4-triphenylbutyl)-1,1-dimethylurea (PubChem CID 134836537) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-(4-hydroxy-3,4,4-triphenylbutyl)-1,1-dimethylurea.
| Compound Name | 3-(4-hydroxy-3,4,4-triphenylbutyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 134836537 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 3-(4-hydroxy-3,4,4-triphenylbutyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCC(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O2/c1-27(2)24(28)26-19-18-23(20-12-6-3-7-13-20)25(29,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23,29H,18-19H2,1-2H3,(H,26,28) |
| InChIKey | MOFLLWQCMWZQAA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |