C18H29NO6 — CID 134836543
ethyl (1R,2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-3-ene-1-carboxylate (PubChem CID 134836543) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is ethyl (1R,2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134836543 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | ethyl (1R,2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC=C[C@@H]1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO6/c1-8-23-14(20)12-10-9-11-13(12)19(15(21)24-17(2,3)4)16(22)25-18(5,6)7/h9,11-13H,8,10H2,1-7H3/t12-,13+/m1/s1 |
| InChIKey | FDKJBOLMUBXVPH-OLZOCXBDSA-N |
| XLogP | 3.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|