About 5-(4-methylphenyl)-4,6-diphenyltriazine
5-(4-methylphenyl)-4,6-diphenyltriazine (PubChem CID 13483660) has the molecular formula C22H17N3
and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-(4-methylphenyl)-4,6-diphenyltriazine.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)-4,6-diphenyltriazine |
| PubChem CID | 13483660 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 5-(4-methylphenyl)-4,6-diphenyltriazine |
| SMILES | Cc1ccc(-c2c(-c3ccccc3)nnnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17N3/c1-16-12-14-17(15-13-16)20-21(18-8-4-2-5-9-18)23-25-24-22(20)19-10-6-3-7-11-19/h2-15H,1H3 |
| InChIKey | DYRUYANPDGWOCV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-methylphenyl)-4,6-diphenyltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)-4,6-diphenyltriazine?
The IUPAC name of 5-(4-methylphenyl)-4,6-diphenyltriazine (CID 13483660) is 5-(4-methylphenyl)-4,6-diphenyltriazine.
What is the SMILES notation for 5-(4-methylphenyl)-4,6-diphenyltriazine?
The canonical SMILES for 5-(4-methylphenyl)-4,6-diphenyltriazine is Cc1ccc(-c2c(-c3ccccc3)nnnc2-c2ccccc2)cc1.
What is the InChIKey of 5-(4-methylphenyl)-4,6-diphenyltriazine?
The InChIKey is DYRUYANPDGWOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3/c1-16-12-14-17(15-13-16)20-21(18-8-4-2-5-9-18)23-25-24-22(20)19-10-6-3-7-11-19/h2-15H,1H3.
What are the key properties of 5-(4-methylphenyl)-4,6-diphenyltriazine?
5-(4-methylphenyl)-4,6-diphenyltriazine has a molecular weight of 323.40 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)-4,6-diphenyltriazine is sourced from PubChem (CID 13483660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).