C15H28O5 — CID 134836601
3-[(4S,5R)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid (PubChem CID 134836601) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is 3-[(4S,5R)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid.
| Compound Name | 3-[(4S,5R)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 134836601 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 3-[(4S,5R)-5-[(6S)-6-hydroxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
| SMILES | C[C@H](O)CCCCC[C@H]1OC(C)(C)O[C@H]1CCC(=O)O |
| InChI | InChI=1S/C15H28O5/c1-11(16)7-5-4-6-8-12-13(9-10-14(17)18)20-15(2,3)19-12/h11-13,16H,4-10H2,1-3H3,(H,17,18)/t11-,12+,13-/m0/s1 |
| InChIKey | XDEXPLHNGNJJJE-XQQFMLRXSA-N |
| XLogP | 2.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|