C24H25NO — CID 134836713
(S)-(2,3-diphenyl-1-propylaziridin-2-yl)-phenylmethanol (PubChem CID 134836713) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is (S)-(2,3-diphenyl-1-propylaziridin-2-yl)-phenylmethanol.
| Compound Name | (S)-(2,3-diphenyl-1-propylaziridin-2-yl)-phenylmethanol |
|---|---|
| PubChem CID | 134836713 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (S)-(2,3-diphenyl-1-propylaziridin-2-yl)-phenylmethanol |
| SMILES | CCCN1C(c2ccccc2)C1(c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C24H25NO/c1-2-18-25-22(19-12-6-3-7-13-19)24(25,21-16-10-5-11-17-21)23(26)20-14-8-4-9-15-20/h3-17,22-23,26H,2,18H2,1H3/t22?,23-,24?,25?/m0/s1 |
| InChIKey | DNTXMJHUKMIQSE-IYQSZBERSA-N |
| XLogP | 5.08 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|