C23H33NO6 — CID 134836752
[(3R,4R,5S,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-methylpropanoate (PubChem CID 134836752) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-methylpropanoate.
| Compound Name | [(3R,4R,5S,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 134836752 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | [(3R,4R,5S,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-4,6-dimethyl-7-oxoheptan-3-yl] 2-methylpropanoate |
| SMILES | CC[C@@H](OC(=O)C(C)C)[C@H](C)[C@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H33NO6/c1-6-19(30-22(27)14(2)3)15(4)20(25)16(5)21(26)24-18(13-29-23(24)28)12-17-10-8-7-9-11-17/h7-11,14-16,18-20,25H,6,12-13H2,1-5H3/t15-,16-,18-,19+,20-/m0/s1 |
| InChIKey | YVLIOQOEKFZRMZ-HNULKUCHSA-N |
| XLogP | 3.19 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |