C20H29NO5 — CID 134836788
tert-butyl (2R,3R)-3-(methoxymethoxy)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134836788) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-(methoxymethoxy)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-(methoxymethoxy)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134836788 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | tert-butyl (2R,3R)-3-(methoxymethoxy)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COCO[C@@H]1C=CCN(C(=O)OC(C)(C)C)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C20H29NO5/c1-20(2,3)26-19(22)21-12-8-11-18(25-15-23-4)17(21)14-24-13-16-9-6-5-7-10-16/h5-11,17-18H,12-15H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | AOCVJHFWQXTMSC-QZTJIDSGSA-N |
| XLogP | 3.37 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|