C15H30O5Si — CID 134836901
(1S,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-(methoxymethoxy)cyclohex-2-en-1-ol (PubChem CID 134836901) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is (1S,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-(methoxymethoxy)cyclohex-2-en-1-ol.
| Compound Name | (1S,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-(methoxymethoxy)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 134836901 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (1S,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-4-(methoxymethoxy)cyclohex-2-en-1-ol |
| SMILES | COCO[C@H]1C=C[C@H](O)[C@@H](OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O5Si/c1-15(2,3)21(6,7)20-14-12(19-10-17-4)9-8-11(16)13(14)18-5/h8-9,11-14,16H,10H2,1-7H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | NPZPQBALETYZKI-IGQOVBAYSA-N |
| XLogP | 2.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|