C22H15BrN2O3 — CID 134837000
(E)-1-(2-bromo-5-nitrophenyl)-N-[(1R)-1,3-diphenylprop-2-ynoxy]methanimine (PubChem CID 134837000) has the molecular formula C22H15BrN2O3 and a molecular weight of 435.28 g/mol. Its IUPAC name is (E)-1-(2-bromo-5-nitrophenyl)-N-[(1R)-1,3-diphenylprop-2-ynoxy]methanimine.
| Compound Name | (E)-1-(2-bromo-5-nitrophenyl)-N-[(1R)-1,3-diphenylprop-2-ynoxy]methanimine |
|---|---|
| PubChem CID | 134837000 |
| Molecular Formula | C22H15BrN2O3 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | (E)-1-(2-bromo-5-nitrophenyl)-N-[(1R)-1,3-diphenylprop-2-ynoxy]methanimine |
| SMILES | O=[N+]([O-])c1ccc(Br)c(/C=N/O[C@@H](C#Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H15BrN2O3/c23-21-13-12-20(25(26)27)15-19(21)16-24-28-22(18-9-5-2-6-10-18)14-11-17-7-3-1-4-8-17/h1-10,12-13,15-16,22H/b24-16+/t22-/m0/s1 |
| InChIKey | HMJZLJXHNPBNMR-OLCUMFGGSA-N |
| XLogP | 5.50 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|