C40H63NO11 — CID 134837014
ethyl (5S)-5-(4-methylphenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pentanoate (PubChem CID 134837014) has the molecular formula C40H63NO11 and a molecular weight of 733.94 g/mol. Its IUPAC name is ethyl (5S)-5-(4-methylphenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pentanoate.
| Compound Name | ethyl (5S)-5-(4-methylphenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pentanoate |
|---|---|
| PubChem CID | 134837014 |
| Molecular Formula | C40H63NO11 |
| Molecular Weight | 733.94 g/mol |
| Exact Mass | 733.44 |
| IUPAC Name | ethyl (5S)-5-(4-methylphenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pentanoate |
| SMILES | CCOC(=O)CCC[C@H](N[C@@H]1OC(COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C40H63NO11/c1-15-47-28(42)18-16-17-26(25-21-19-24(2)20-22-25)41-32-31(52-36(46)40(12,13)14)30(51-35(45)39(9,10)11)29(50-34(44)38(6,7)8)27(49-32)23-48-33(43)37(3,4)5/h19-22,26-27,29-32,41H,15-18,23H2,1-14H3/t26-,27?,29-,30?,31?,32+/m0/s1 |
| InChIKey | KWRKPHUWBFZQHJ-QXGFBANTSA-N |
| XLogP | 6.55 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.94 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|