About phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone
phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone (PubChem CID 134837067) has the molecular formula C20H18N2O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone.
Molecular Properties
| Compound Name | phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone |
| PubChem CID | 134837067 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone |
| SMILES | O=C(c1ccccc1)N1CC2CC1C1C(c3ccccc3)=NOC21 |
| InChI | InChI=1S/C20H18N2O2/c23-20(14-9-5-2-6-10-14)22-12-15-11-16(22)17-18(21-24-19(15)17)13-7-3-1-4-8-13/h1-10,15-17,19H,11-12H2 |
| InChIKey | BKPJSAYEDWBVIQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone?
The IUPAC name of phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone (CID 134837067) is phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone.
What is the SMILES notation for phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone?
The canonical SMILES for phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone is O=C(c1ccccc1)N1CC2CC1C1C(c3ccccc3)=NOC21.
What is the InChIKey of phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone?
The InChIKey is BKPJSAYEDWBVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2/c23-20(14-9-5-2-6-10-14)22-12-15-11-16(22)17-18(21-24-19(15)17)13-7-3-1-4-8-13/h1-10,15-17,19H,11-12H2.
What are the key properties of phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone?
phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone has a molecular weight of 318.38 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(5-phenyl-3-oxa-4,8-diazatricyclo[5.2.1.02,6]dec-4-en-8-yl)methanone is sourced from PubChem (CID 134837067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).