C39H58ClNO11 — CID 134837074
ethyl (E,5S)-5-(4-chlorophenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate (PubChem CID 134837074) has the molecular formula C39H58ClNO11 and a molecular weight of 752.34 g/mol. Its IUPAC name is ethyl (E,5S)-5-(4-chlorophenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate.
| Compound Name | ethyl (E,5S)-5-(4-chlorophenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 134837074 |
| Molecular Formula | C39H58ClNO11 |
| Molecular Weight | 752.34 g/mol |
| Exact Mass | 751.37 |
| IUPAC Name | ethyl (E,5S)-5-(4-chlorophenyl)-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](N[C@@H]1OC(COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C39H58ClNO11/c1-14-47-27(42)17-15-16-25(23-18-20-24(40)21-19-23)41-31-30(52-35(46)39(11,12)13)29(51-34(45)38(8,9)10)28(50-33(44)37(5,6)7)26(49-31)22-48-32(43)36(2,3)4/h15,17-21,25-26,28-31,41H,14,16,22H2,1-13H3/b17-15+/t25-,26?,28-,29?,30?,31+/m0/s1 |
| InChIKey | VLDAAHJUFNAOAS-TUPNGQESSA-N |
| XLogP | 6.67 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.34 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|