C27H35NO2S2Si — CID 134837154
(E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-4-en-1-one (PubChem CID 134837154) has the molecular formula C27H35NO2S2Si and a molecular weight of 497.80 g/mol. Its IUPAC name is (E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-4-en-1-one.
| Compound Name | (E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 134837154 |
| Molecular Formula | C27H35NO2S2Si |
| Molecular Weight | 497.80 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (E,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-4-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/c1ccccc1)CC(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H35NO2S2Si/c1-27(2,3)33(4,5)30-24(17-16-21-12-8-6-9-13-21)19-25(29)28-23(20-32-26(28)31)18-22-14-10-7-11-15-22/h6-17,23-24H,18-20H2,1-5H3/b17-16+/t23-,24-/m0/s1 |
| InChIKey | UMAQFXKCVBXCND-HECZBFAXSA-N |
| XLogP | 6.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.80 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|