C20H29NO3Si — CID 134837348
ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate (PubChem CID 134837348) has the molecular formula C20H29NO3Si and a molecular weight of 359.54 g/mol. Its IUPAC name is ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate.
| Compound Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate |
|---|---|
| PubChem CID | 134837348 |
| Molecular Formula | C20H29NO3Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate |
| SMILES | CCOC(=O)c1c2n(c3ccccc13)C[C@@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C20H29NO3Si/c1-7-23-19(22)18-15-10-8-9-11-16(15)21-13-14(12-17(18)21)24-25(5,6)20(2,3)4/h8-11,14H,7,12-13H2,1-6H3/t14-/m0/s1 |
| InChIKey | FCHABXKYRAKSNW-AWEZNQCLSA-N |
| XLogP | 4.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|