C14H14F3NO4 — CID 134837356
(4R,7R,8S,8aS)-7,8-dihydroxy-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 134837356) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is (4R,7R,8S,8aS)-7,8-dihydroxy-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4R,7R,8S,8aS)-7,8-dihydroxy-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 134837356 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (4R,7R,8S,8aS)-7,8-dihydroxy-4-phenyl-8a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N2C[C@@H](O)[C@@H](O)[C@@]12C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO4/c15-14(16,17)13-11(20)10(19)6-18(13)9(7-22-12(13)21)8-4-2-1-3-5-8/h1-5,9-11,19-20H,6-7H2/t9-,10+,11+,13-/m0/s1 |
| InChIKey | ALOUBLWGMOFBJD-WGBDABJCSA-N |
| XLogP | 0.62 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |