C14H12F3NO2 — CID 134837357
(4R,8aS)-4-phenyl-8a-(trifluoromethyl)-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 134837357) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is (4R,8aS)-4-phenyl-8a-(trifluoromethyl)-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4R,8aS)-4-phenyl-8a-(trifluoromethyl)-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 134837357 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (4R,8aS)-4-phenyl-8a-(trifluoromethyl)-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N2CC=C[C@@]12C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)13-7-4-8-18(13)11(9-20-12(13)19)10-5-2-1-3-6-10/h1-7,11H,8-9H2/t11-,13-/m0/s1 |
| InChIKey | XBBIULHJYSSEFU-AAEUAGOBSA-N |
| XLogP | 2.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|