About trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane
trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane (PubChem CID 134837430) has the molecular formula C19H40SiSn
and a molecular weight of 415.33 g/mol. Its IUPAC name is trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane |
| PubChem CID | 134837430 |
| Molecular Formula | C19H40SiSn |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane |
| SMILES | C=C/C(=C/[Si](C)(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C7H13Si.3C4H9.Sn/c1-5-6-7-8(2,3)4;3*1-3-4-2;/h5,7H,1H2,2-4H3;3*1,3-4H2,2H3; |
| InChIKey | KDKLCPRVCXXLRV-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane?
The IUPAC name of trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane (CID 134837430) is trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane.
What is the SMILES notation for trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane?
The canonical SMILES for trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane is C=C/C(=C/[Si](C)(C)C)[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane?
The InChIKey is KDKLCPRVCXXLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Si.3C4H9.Sn/c1-5-6-7-8(2,3)4;3*1-3-4-2;/h5,7H,1H2,2-4H3;3*1,3-4H2,2H3;.
What are the key properties of trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane?
trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane has a molecular weight of 415.33 g/mol, XLogP of 7.36, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1Z)-2-tributylstannylbuta-1,3-dienyl]silane is sourced from PubChem (CID 134837430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).