C22H24O7 — CID 134837435
dimethyl (2R,3S)-6-hydroxy-1,5-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate (PubChem CID 134837435) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is dimethyl (2R,3S)-6-hydroxy-1,5-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3S)-6-hydroxy-1,5-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134837435 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | dimethyl (2R,3S)-6-hydroxy-1,5-dimethoxy-4-phenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(OC)c2ccc(O)c(OC)c2C(c2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H24O7/c1-26-19-13-10-11-14(23)20(27-2)16(13)15(12-8-6-5-7-9-12)17(21(24)28-3)18(19)22(25)29-4/h5-11,15,17-19,23H,1-4H3/t15?,17-,18+,19?/m0/s1 |
| InChIKey | IFRSLJGOZOXEQP-PZZKWDHKSA-N |
| XLogP | 2.81 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |