C24H31N3 — CID 134837445
[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-yl]-propan-2-ylazanide (PubChem CID 134837445) has the molecular formula C24H31N3 and a molecular weight of 361.53 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-yl]-propan-2-ylazanide.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-yl]-propan-2-ylazanide |
|---|---|
| PubChem CID | 134837445 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-yl]-propan-2-ylazanide |
| SMILES | Cc1cc(C)c(-n2c[n+](-c3c(C)cc(C)cc3C)cc2[N-]C(C)C)c(C)c1 |
| InChI | InChI=1S/C24H31N3/c1-15(2)25-22-13-26(23-18(5)9-16(3)10-19(23)6)14-27(22)24-20(7)11-17(4)12-21(24)8/h9-15H,1-8H3 |
| InChIKey | DBPFNHJZXQECCC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 22.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|