About 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one
5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 13483763) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 13483763 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1ncc2c(=O)n(N)cnc21 |
| InChI | InChI=1S/C6H7N5O/c1-10-5-4(2-9-10)6(12)11(7)3-8-5/h2-3H,7H2,1H3 |
| InChIKey | TVKDNILWGVYQAU-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one (CID 13483763) is 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one is Cn1ncc2c(=O)n(N)cnc21.
What is the InChIKey of 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is TVKDNILWGVYQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c1-10-5-4(2-9-10)6(12)11(7)3-8-5/h2-3H,7H2,1H3.
What are the key properties of 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one?
5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 165.16 g/mol, XLogP of -1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 13483763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).