2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane

C10H18O — CID 134837710

IUPAC2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane
SMILESC=C[C@H](C)CCC1OC1(C)C
InChIInChI=1S/C10H18O/c1-5-8(2)6-7-9-10(3,4)11-9/h5,8-9H,1,6-7H2,2-4H3/t8-,9?/m0/s1
InChIKeyIQTYEDULQISSGT-IENPIDJESA-N
MW154.25 g/mol
LogP2.77
Rot. Bonds4

About 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane

2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane (PubChem CID 134837710) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane.

Molecular Properties

Compound Name2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane
PubChem CID134837710
Molecular FormulaC10H18O
Molecular Weight154.25 g/mol
Exact Mass154.14
IUPAC Name2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane
SMILESC=C[C@H](C)CCC1OC1(C)C
InChIInChI=1S/C10H18O/c1-5-8(2)6-7-9-10(3,4)11-9/h5,8-9H,1,6-7H2,2-4H3/t8-,9?/m0/s1
InChIKeyIQTYEDULQISSGT-IENPIDJESA-N
XLogP2.77
TPSA12.53 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.25
LogP ≤ 52.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 122371
CID 122371
CID 527249
CID 527249
CID 86128
CID 86128
CID 103825
CID 103825
CID 56936246
CID 56936246
CID 92279147
CID 92279147
CID 76463834
CID 76463834
CID 10909791
CID 10909791
CID 85987834
CID 85987834
CID 6429137
CID 6429137
CID 11263534
CID 11263534
CID 42608271
CID 42608271

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane?
The IUPAC name of 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane (CID 134837710) is 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane.
What is the SMILES notation for 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane?
The canonical SMILES for 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane is C=C[C@H](C)CCC1OC1(C)C.
What is the InChIKey of 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane?
The InChIKey is IQTYEDULQISSGT-IENPIDJESA-N. The full InChI is InChI=1S/C10H18O/c1-5-8(2)6-7-9-10(3,4)11-9/h5,8-9H,1,6-7H2,2-4H3/t8-,9?/m0/s1.
What are the key properties of 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane?
2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane has a molecular weight of 154.25 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-[(3R)-3-methylpent-4-enyl]oxirane is sourced from PubChem (CID 134837710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).