C19H23NO6 — CID 134837818
(3aS,6R,7aS)-4'-(3,5-dimethylphenyl)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione (PubChem CID 134837818) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (3aS,6R,7aS)-4'-(3,5-dimethylphenyl)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione.
| Compound Name | (3aS,6R,7aS)-4'-(3,5-dimethylphenyl)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione |
|---|---|
| PubChem CID | 134837818 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (3aS,6R,7aS)-4'-(3,5-dimethylphenyl)-2,2-dimethylspiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,6'-morpholine]-3',7-dione |
| SMILES | Cc1cc(C)cc(N2C[C@]3(OCC2=O)OC[C@@H]2OC(C)(C)O[C@@H]2C3=O)c1 |
| InChI | InChI=1S/C19H23NO6/c1-11-5-12(2)7-13(6-11)20-10-19(24-9-15(20)21)17(22)16-14(8-23-19)25-18(3,4)26-16/h5-7,14,16H,8-10H2,1-4H3/t14-,16-,19+/m0/s1 |
| InChIKey | RTMIZCXHHVGLJC-URLQWDBASA-N |
| XLogP | 1.48 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |