C21H34O5Si — CID 134837826
(4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-1,3-dioxan-5-one (PubChem CID 134837826) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-1,3-dioxan-5-one.
| Compound Name | (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 134837826 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | (4S)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-phenylethyl]-2,2-dimethyl-1,3-dioxan-5-one |
| SMILES | CO[C@H]([C@@H]1OC(C)(C)OCC1=O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H34O5Si/c1-20(2,3)27(7,8)26-17(15-12-10-9-11-13-15)19(23-6)18-16(22)14-24-21(4,5)25-18/h9-13,17-19H,14H2,1-8H3/t17-,18-,19+/m1/s1 |
| InChIKey | VBGHPWSLEOLSKI-QRVBRYPASA-N |
| XLogP | 4.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|