C38H36N2O2 — CID 134837929
[(4S,5S)-5-[(benzylideneamino)-diphenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanamine (PubChem CID 134837929) has the molecular formula C38H36N2O2 and a molecular weight of 552.72 g/mol. Its IUPAC name is [(4S,5S)-5-[(benzylideneamino)-diphenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanamine.
| Compound Name | [(4S,5S)-5-[(benzylideneamino)-diphenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanamine |
|---|---|
| PubChem CID | 134837929 |
| Molecular Formula | C38H36N2O2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | [(4S,5S)-5-[(benzylideneamino)-diphenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanamine |
| SMILES | CC1(C)O[C@@H](C(N)(c2ccccc2)c2ccccc2)[C@H](C(/N=C/c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C38H36N2O2/c1-36(2)41-34(37(39,30-20-10-4-11-21-30)31-22-12-5-13-23-31)35(42-36)38(32-24-14-6-15-25-32,33-26-16-7-17-27-33)40-28-29-18-8-3-9-19-29/h3-28,34-35H,39H2,1-2H3/b40-28+/t34-,35-/m1/s1 |
| InChIKey | SXMRZBXVHQQSFF-UFPSBGLUSA-N |
| XLogP | 7.47 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|