About 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+)
1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) (PubChem CID 134837934) has the molecular formula C12H20AuO2+
and a molecular weight of 393.26 g/mol. Its IUPAC name is 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+).
Molecular Properties
| Compound Name | 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) |
| PubChem CID | 134837934 |
| Molecular Formula | C12H20AuO2+ |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) |
| SMILES | [Au+].[H]/[C-]=C(/OCC)C1CCCCC1O[CH+]C |
| InChI | InChI=1S/C12H20O2.Au/c1-4-13-10(3)11-8-6-7-9-12(11)14-5-2;/h3,5,11-12H,4,6-9H2,1-2H3;/q;+1 |
| InChIKey | ZCOALRSDLWFLSN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+)?
The IUPAC name of 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) (CID 134837934) is 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+).
What is the SMILES notation for 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+)?
The canonical SMILES for 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) is [Au+].[H]/[C-]=C(/OCC)C1CCCCC1O[CH+]C.
What is the InChIKey of 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+)?
The InChIKey is ZCOALRSDLWFLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2.Au/c1-4-13-10(3)11-8-6-7-9-12(11)14-5-2;/h3,5,11-12H,4,6-9H2,1-2H3;/q;+1.
What are the key properties of 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+)?
1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) has a molecular weight of 393.26 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2-(1-ethoxyethenyl)cyclohexane;gold(1+) is sourced from PubChem (CID 134837934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).