About [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane
[(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 134837952) has the molecular formula C19H38O2Si2
and a molecular weight of 354.68 g/mol. Its IUPAC name is [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane |
| PubChem CID | 134837952 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | C=CCC[C@@H]1C=C(O[Si](C)(C)C)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2Si2/c1-10-11-12-16-15-17(20-22(5,6)7)13-14-18(16)21-23(8,9)19(2,3)4/h10,15-16,18H,1,11-14H2,2-9H3/t16-,18-/m1/s1 |
| InChIKey | UJYBJYGVCOZGIR-SJLPKXTDSA-N |
| XLogP | 6.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane?
The IUPAC name of [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane (CID 134837952) is [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane.
What is the SMILES notation for [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane?
The canonical SMILES for [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane is C=CCC[C@@H]1C=C(O[Si](C)(C)C)CC[C@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane?
The InChIKey is UJYBJYGVCOZGIR-SJLPKXTDSA-N. The full InChI is InChI=1S/C19H38O2Si2/c1-10-11-12-16-15-17(20-22(5,6)7)13-14-18(16)21-23(8,9)19(2,3)4/h10,15-16,18H,1,11-14H2,2-9H3/t16-,18-/m1/s1.
What are the key properties of [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane?
[(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane has a molecular weight of 354.68 g/mol, XLogP of 6.49, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-3-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]oxy-trimethylsilane is sourced from PubChem (CID 134837952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).