C16H30O5Si2 — CID 134837995
1-[1,4-dimethyl-3,6-bis(trimethylsilyloxy)-2,5-dioxabicyclo[4.2.0]oct-3-en-7-yl]ethanone (PubChem CID 134837995) has the molecular formula C16H30O5Si2 and a molecular weight of 358.58 g/mol. Its IUPAC name is 1-[1,4-dimethyl-3,6-bis(trimethylsilyloxy)-2,5-dioxabicyclo[4.2.0]oct-3-en-7-yl]ethanone.
| Compound Name | 1-[1,4-dimethyl-3,6-bis(trimethylsilyloxy)-2,5-dioxabicyclo[4.2.0]oct-3-en-7-yl]ethanone |
|---|---|
| PubChem CID | 134837995 |
| Molecular Formula | C16H30O5Si2 |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[1,4-dimethyl-3,6-bis(trimethylsilyloxy)-2,5-dioxabicyclo[4.2.0]oct-3-en-7-yl]ethanone |
| SMILES | CC(=O)C1CC2(C)OC(O[Si](C)(C)C)=C(C)OC12O[Si](C)(C)C |
| InChI | InChI=1S/C16H30O5Si2/c1-11(17)13-10-15(3)16(13,21-23(7,8)9)18-12(2)14(19-15)20-22(4,5)6/h13H,10H2,1-9H3 |
| InChIKey | VENOINBJFGFLMF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|