C14H12N4O4 — CID 134838028
6-amino-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1H-pyrimidine-2,4-dione (PubChem CID 134838028) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is 6-amino-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134838028 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 6-amino-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-1H-pyrimidine-2,4-dione |
| SMILES | Nc1[nH]c(=O)[nH]c(=O)c1C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C14H12N4O4/c15-11-10(12(20)17-14(22)16-11)8-6-9(19)18(13(8)21)7-4-2-1-3-5-7/h1-5,8H,6H2,(H4,15,16,17,20,22) |
| InChIKey | KPZBWOKKBBWAGC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|