C12H15NS — CID 134838226
N,N-dimethyl-3-(4-methylphenyl)sulfanylprop-2-yn-1-amine (PubChem CID 134838226) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is N,N-dimethyl-3-(4-methylphenyl)sulfanylprop-2-yn-1-amine.
| Compound Name | N,N-dimethyl-3-(4-methylphenyl)sulfanylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 134838226 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N,N-dimethyl-3-(4-methylphenyl)sulfanylprop-2-yn-1-amine |
| SMILES | Cc1ccc(SC#CCN(C)C)cc1 |
| InChI | InChI=1S/C12H15NS/c1-11-5-7-12(8-6-11)14-10-4-9-13(2)3/h5-8H,9H2,1-3H3 |
| InChIKey | VFDCQSXRWGFDQT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|