C22H48O3Si2 — CID 134838241
(8R,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]decan-2-one (PubChem CID 134838241) has the molecular formula C22H48O3Si2 and a molecular weight of 416.80 g/mol. Its IUPAC name is (8R,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]decan-2-one.
| Compound Name | (8R,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]decan-2-one |
|---|---|
| PubChem CID | 134838241 |
| Molecular Formula | C22H48O3Si2 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (8R,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]decan-2-one |
| SMILES | CC(=O)CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O3Si2/c1-18(23)16-14-13-15-17-20(25-27(11,12)22(6,7)8)19(2)24-26(9,10)21(3,4)5/h19-20H,13-17H2,1-12H3/t19-,20+/m0/s1 |
| InChIKey | CEYIPMVRISHVAS-VQTJNVASSA-N |
| XLogP | 7.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|