C16H21NO2S2 — CID 134838283
2-(4-acetylphenyl)-N-ethyl-2-methyl-1,3-dithiane-5-carboxamide (PubChem CID 134838283) has the molecular formula C16H21NO2S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-N-ethyl-2-methyl-1,3-dithiane-5-carboxamide.
| Compound Name | 2-(4-acetylphenyl)-N-ethyl-2-methyl-1,3-dithiane-5-carboxamide |
|---|---|
| PubChem CID | 134838283 |
| Molecular Formula | C16H21NO2S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-(4-acetylphenyl)-N-ethyl-2-methyl-1,3-dithiane-5-carboxamide |
| SMILES | CCNC(=O)C1CSC(C)(c2ccc(C(C)=O)cc2)SC1 |
| InChI | InChI=1S/C16H21NO2S2/c1-4-17-15(19)13-9-20-16(3,21-10-13)14-7-5-12(6-8-14)11(2)18/h5-8,13H,4,9-10H2,1-3H3,(H,17,19) |
| InChIKey | IYYIBLBJAYHMIJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |