C27H29FO5 — CID 134838290
(2R,5S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 134838290) has the molecular formula C27H29FO5 and a molecular weight of 452.52 g/mol. Its IUPAC name is (2R,5S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (2R,5S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 134838290 |
| Molecular Formula | C27H29FO5 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (2R,5S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | O[C@@H]1OC(CF)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C27H29FO5/c28-16-23-24(30-17-20-10-4-1-5-11-20)25(31-18-21-12-6-2-7-13-21)26(27(29)33-23)32-19-22-14-8-3-9-15-22/h1-15,23-27,29H,16-19H2/t23?,24-,25?,26?,27-/m1/s1 |
| InChIKey | IECMESMCNCLHFW-CFWNNJLBSA-N |
| XLogP | 4.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |