About (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine
(2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine (PubChem CID 134838483) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine.
Molecular Properties
| Compound Name | (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine |
| PubChem CID | 134838483 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine |
| SMILES | C=CC[C@@H](C)C1=CC=C[C@H](C)N1C |
| InChI | InChI=1S/C12H19N/c1-5-7-10(2)12-9-6-8-11(3)13(12)4/h5-6,8-11H,1,7H2,2-4H3/t10-,11+/m1/s1 |
| InChIKey | OLZZBNZSGCIPGR-MNOVXSKESA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine?
The IUPAC name of (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine (CID 134838483) is (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine.
What is the SMILES notation for (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine?
The canonical SMILES for (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine is C=CC[C@@H](C)C1=CC=C[C@H](C)N1C.
What is the InChIKey of (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine?
The InChIKey is OLZZBNZSGCIPGR-MNOVXSKESA-N. The full InChI is InChI=1S/C12H19N/c1-5-7-10(2)12-9-6-8-11(3)13(12)4/h5-6,8-11H,1,7H2,2-4H3/t10-,11+/m1/s1.
What are the key properties of (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine?
(2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine has a molecular weight of 177.29 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-dimethyl-6-[(2R)-pent-4-en-2-yl]-2H-pyridine is sourced from PubChem (CID 134838483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).