C21H25NO7 — CID 134838490
methyl (2R,3aS,6R,6aR)-2-ethenyl-6a-(2-methoxy-2-oxoethyl)-5-[(4-methoxyphenyl)methyl]-4-oxo-2,3,3a,6-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate (PubChem CID 134838490) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is methyl (2R,3aS,6R,6aR)-2-ethenyl-6a-(2-methoxy-2-oxoethyl)-5-[(4-methoxyphenyl)methyl]-4-oxo-2,3,3a,6-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate.
| Compound Name | methyl (2R,3aS,6R,6aR)-2-ethenyl-6a-(2-methoxy-2-oxoethyl)-5-[(4-methoxyphenyl)methyl]-4-oxo-2,3,3a,6-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 134838490 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | methyl (2R,3aS,6R,6aR)-2-ethenyl-6a-(2-methoxy-2-oxoethyl)-5-[(4-methoxyphenyl)methyl]-4-oxo-2,3,3a,6-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate |
| SMILES | C=C[C@H]1C[C@@H]2C(=O)N(Cc3ccc(OC)cc3)[C@@H](C(=O)OC)[C@]2(CC(=O)OC)O1 |
| InChI | InChI=1S/C21H25NO7/c1-5-14-10-16-19(24)22(12-13-6-8-15(26-2)9-7-13)18(20(25)28-4)21(16,29-14)11-17(23)27-3/h5-9,14,16,18H,1,10-12H2,2-4H3/t14-,16+,18-,21+/m0/s1 |
| InChIKey | XWMSXSJFDTVQOI-DJXDEVDJSA-N |
| XLogP | 1.47 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|