About N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide
N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide (PubChem CID 134838608) has the molecular formula C20H25FN2O2S
and a molecular weight of 376.50 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide.
Molecular Properties
| Compound Name | N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide |
| PubChem CID | 134838608 |
| Molecular Formula | C20H25FN2O2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide |
| SMILES | CCCN(CCC)/C(Cc1ccc(F)cc1)=N\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25FN2O2S/c1-3-14-23(15-4-2)20(16-17-10-12-18(21)13-11-17)22-26(24,25)19-8-6-5-7-9-19/h5-13H,3-4,14-16H2,1-2H3/b22-20- |
| InChIKey | RZPPVJDYHXBQSK-XDOYNYLZSA-N |
| XLogP | 4.28 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide?
The IUPAC name of N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide (CID 134838608) is N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide.
What is the SMILES notation for N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide?
The canonical SMILES for N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide is CCCN(CCC)/C(Cc1ccc(F)cc1)=N\S(=O)(=O)c1ccccc1.
What is the InChIKey of N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide?
The InChIKey is RZPPVJDYHXBQSK-XDOYNYLZSA-N. The full InChI is InChI=1S/C20H25FN2O2S/c1-3-14-23(15-4-2)20(16-17-10-12-18(21)13-11-17)22-26(24,25)19-8-6-5-7-9-19/h5-13H,3-4,14-16H2,1-2H3/b22-20-.
What are the key properties of N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide?
N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide has a molecular weight of 376.50 g/mol, XLogP of 4.28, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzenesulfonyl)-2-(4-fluorophenyl)-N,N-dipropylethanimidamide is sourced from PubChem (CID 134838608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).