C28H34N2 — CID 134838632
1-N,2-N-bis(2,6-dimethylphenyl)-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-diimine (PubChem CID 134838632) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 1-N,2-N-bis(2,6-dimethylphenyl)-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis(2,6-dimethylphenyl)-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 134838632 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1-N,2-N-bis(2,6-dimethylphenyl)-3,3a,4,5,5a,6,7,8,8a,8b-decahydroacenaphthylene-1,2-diimine |
| SMILES | Cc1cccc(C)c1/N=C1C(=N/c2c(C)cccc2C)/C2CCCC3CCCC/1C32 |
| InChI | InChI=1S/C28H34N2/c1-17-9-5-10-18(2)25(17)29-27-22-15-7-13-21-14-8-16-23(24(21)22)28(27)30-26-19(3)11-6-12-20(26)4/h5-6,9-12,21-24H,7-8,13-16H2,1-4H3/b29-27+,30-28+ |
| InChIKey | WLVXXJKWANFAJS-QAVVBOBSSA-N |
| XLogP | 7.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|